Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 2244-16-8, Name is (S)-2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-enone, SMILES is C=C([C@H](C1)CC=C(C)C1=O)C, belongs to chiral-catalyst compound. In a document, author is Bertuzzi, Giulio, introduce the new discover, Recommanded Product: (S)-2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-enone.
A highly stereoselective 1,3-dipolar [6+4] cycloaddition towards bridged azabicyclo[4.3.1]decane scaffolds has been developed, reacting aldehydes, 2-aminomalonates and tropone under mild conditions in the presence of a chiral phosphoric acid catalyst. The scope is demonstrated for a series of aldehydes and 2-aminomalonates, and the reaction proceeds in high yields, >95:5 d.r. and up to 99 % ee. A series of transformations, as well as a mechanistic proposal, are presented.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 2244-16-8 is helpful to your research. Recommanded Product: (S)-2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-enone.
Reference:
Chiral Catalysts,
,Chiral catalysts – SlideShare