Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Application In Synthesis of N-Acetyl-D-glucosamine, 7512-17-6, Name is N-Acetyl-D-glucosamine, SMILES is O=C[C@H](NC(C)=O)[C@H]([C@@H]([C@@H](CO)O)O)O, belongs to chiral-catalyst compound. In a document, author is Li, Chonglong, introduce the new discover.
A novel helical poly(phenyl isocyanide) bearing Boc protectedl-proline pendants (poly-1(m)) was designed and synthesized. Removed the protecting Boc groups on thel-proline pendants led to the formation of helical polymer poly-2(m), which showed high optical activity owing to the preferred right-handed helix of polyisocyanide main chain. Optically active helical poly-2(m)showed excellent catalytic ability on asymmetric aldol reaction. Helical polymer catalysts exhibited enhanced stereoselectivity in aldol reaction compared to small moleculel-proline. Under the optimized aldol reaction condition, the enantiomeric excess (ee) and diastereomeric ratio (dr) values of the aldol reaction product were respectively up to 90% and > 20/1. Moreover, the helical polyisocyanide catalyst Poly-2(m)can be easily recovered and reused in the aldol reaction for at least five cycles with maintained its activity and stereoselectivity. Graphic Abstract Enantioselective aldol reaction catalyzed by poly-2(m). [GRAPHICS]
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 7512-17-6. Application In Synthesis of N-Acetyl-D-glucosamine.
Reference:
Chiral Catalysts,
,Chiral catalysts – SlideShare