New explortion of 59-23-4

The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 59-23-4 is helpful to your research. Safety of D-Galactose.

Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Safety of D-Galactose, 59-23-4, Name is D-Galactose, SMILES is O=C[C@@H]([C@H]([C@H]([C@@H](CO)O)O)O)O, belongs to chiral-catalyst compound. In a document, author is Xu, You-Wei, introduce the new discover.

A copper-catalyzed enantioselective [3 + 3] cycloaddition of 3-ethynyl-2-oxoindolin-3-yl acetates with 1H-pyrazol-5(4H)-ones for the construction of optically active spirooxindoles bearing a spiro all-carbon quaternary stereocenter has been realized. With a combination of Cu(OTf)(2) and chiral tridentate ketimine P,N,N-ligand as the catalyst, the reaction displayed broad substrate scopes, good yields, and high enantioselectivities. This represents the first catalytic asymmetric propargylic cycloaddition with tertiary propargylic esters as the bis-electrophiles for access to chiral spirocyclic frameworks.

The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 59-23-4 is helpful to your research. Safety of D-Galactose.

Reference:
Chiral Catalysts,
,Chiral catalysts – SlideShare